CAS 18282-51-4
:4-Iodobenzyl alcohol
Description:
4-Iodobenzyl alcohol, with the CAS number 18282-51-4, is an organic compound characterized by the presence of an iodine atom and a hydroxyl group (-OH) attached to a benzyl group. It features a benzene ring substituted with an iodine atom at the para position relative to the benzyl alcohol functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate solubility in water due to the polar hydroxyl group. 4-Iodobenzyl alcohol is often utilized in organic synthesis as a building block for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its iodine substituent can facilitate further transformations, making it valuable in medicinal chemistry and materials science. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical applications. Proper handling and storage are essential due to the potential reactivity of the iodine atom and the compound's overall chemical properties.
Formula:C7H7IO
InChI:InChI=1S/C7H7IO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2
InChI key:InChIKey=CNQRHSZYVFYOIE-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(I)C=C1
Synonyms:- (4-Iodophenyl)Methanol
- 4-Iodobenzenemethanol
- Benzenemethanol, 4-iodo-
- Benzyl alcohol, p-iodo-
- Brn 1931621
- p-Iodobenzyl alcohol
- 4-Iodobenzyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Iodobenzyl Alcohol
CAS:Formula:C7H7IOPurity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:234.044-Iodobenzyl alcohol, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7IOPurity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:234.044-Iodobenzyl alcohol
CAS:4-Iodobenzyl alcoholFormula:C7H7IOPurity:≥95%Color and Shape: white to off white solidMolecular weight:234.03435g/mol




