
CAS 182821-27-8
:Daglutril
Description:
Daglutril is a synthetic compound classified as a dual angiotensin II receptor antagonist and neprilysin inhibitor, primarily investigated for its potential therapeutic applications in cardiovascular diseases and heart failure. It functions by modulating the renin-angiotensin-aldosterone system (RAAS) and enhancing the levels of natriuretic peptides, which can lead to vasodilation and improved cardiac function. The chemical structure of Daglutril includes specific functional groups that contribute to its pharmacological activity, although detailed structural information is typically proprietary. Its mechanism of action involves blocking the effects of angiotensin II, a peptide that can cause vasoconstriction and promote fluid retention, while simultaneously inhibiting neprilysin, an enzyme responsible for the degradation of beneficial peptides. This dual action may provide a synergistic effect in managing heart failure symptoms. As with many pharmaceutical compounds, the safety profile, efficacy, and potential side effects are evaluated through clinical trials before approval for medical use.
Formula:C31H38N2O6
InChI:InChI=1S/C31H38N2O6/c1-2-39-29(37)24(15-14-22-10-4-3-5-11-22)20-31(18-8-9-19-31)30(38)32-25-17-16-23-12-6-7-13-26(23)33(28(25)36)21-27(34)35/h3-7,10-13,24-25H,2,8-9,14-21H2,1H3,(H,32,38)(H,34,35)/t24-,25+/m1/s1
InChI key:InChIKey=XMQODGUTLZXUGZ-RPBOFIJWSA-N
SMILES:C([C@@H](CCC1=CC=CC=C1)C(OCC)=O)C2(C(N[C@@H]3C(=O)N(CC(O)=O)C=4C(CC3)=CC=CC4)=O)CCCC2
Synonyms:- 1H-1-Benzazepine-1-acetic acid, 3-[[[1-[(2R)-2-(ethoxycarbonyl)-4-phenylbutyl]cyclopentyl]carbonyl]amino]-2,3,4,5-tetrahydro-2-oxo-, (3S)-
- Daglutril
- 1H-1-Benzazepine-1-acetic acid, 3-[[[1-[2-(ethoxycarbonyl)-4-phenylbutyl]cyclopentyl]carbonyl]amino]-2,3,4,5-tetrahydro-2-oxo-, [S-(R*,S*)]-
- SLV 306
- (3S)-3-[[[1-[(2R)-2-(Ethoxycarbonyl)-4-phenylbutyl]cyclopentyl]carbonyl]amino]-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Daglutril
CAS:Daglutril is a drug which inhibits the enzyme 11-beta-hydroxylase. It has been shown to have an inhibitory effect on humans with cavity, which is due to its ability to inhibit mineralocorticoid receptor and angiotensin system. Daglutril also has an atrial primary analysis effect that is demonstrated in diabetic patients with chronic kidney disease and ventricular dysfunction. Monoclonal antibodies are used for this drug's administration, as it binds to human glycoprotein hormones such as insulin and glucagon, preventing them from binding to their receptors. Daglutril is also effective for metabolic disorders such as type 2 diabetes.Formula:C31H38N2O6Purity:Min. 95%Molecular weight:534.6 g/molDaglutril
CAS:Daglutril is a NEP/ECE inhibitor for treating hypertension, heart failure, and pulmonary issues, blocking big endothelin-1 conversion.Formula:C31H38N2O6Color and Shape:SolidMolecular weight:534.64

