CAS 1829-22-7

2-IODOTEREPHTHALIC ACID

Description:

2-Iodoterephthalic acid is an aromatic dicarboxylic acid characterized by the presence of two carboxylic acid groups (-COOH) and an iodine substituent on the aromatic ring. Its molecular structure features a terephthalic acid backbone, where one of the hydrogen atoms on the benzene ring is replaced by an iodine atom at the 2-position. This compound is typically a white to off-white solid and is soluble in organic solvents, but less so in water due to its hydrophobic aromatic structure. 2-Iodoterephthalic acid is of interest in various chemical applications, including organic synthesis and materials science, particularly in the development of polymers and as a building block for more complex molecules. Its iodine substituent can facilitate further chemical modifications, making it a versatile intermediate in synthetic chemistry. Additionally, the presence of the carboxylic acid groups allows for potential interactions in coordination chemistry and can influence the compound's reactivity and solubility.

Formula: C₈H₅IO₄

InChI: InChI=1S/C8H5IO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=LUZKKRPROWYBLR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(I)=C(C(O)=O)C=C1

Synonyms:

• 1,4-Benzenedicarboxylic Acid, 2-Iodo-
• 2-Iodo-1,4-benzenedicarboxylic acid
• 2-Iodobenzene-1,4-Dicarboxylic Acid
• Iodoterephthalic acid
• Terephthalic acid, iodo-
• 2-Iodoterephthalic acid
• 2-Iodoterephthalic acid

1,4-Benzenedicarboxylic acid, 2-iodo-

CAS: 1829-22-7

Formula: C₈H₅IO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 292.0274

Ref: IN-DA00248B

2-Iodoterephthalic acid

CAS: 1829-22-7

2-Iodoterephthalic acid

Purity: 98%

Molecular weight: 292.03g/mol

Ref: 54-OR74409

2-IODOTEREPHTHALIC ACID

CAS: 1829-22-7

Formula: C₈H₅IO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 292.028

Ref: 10-F467199