CAS 1829-26-1
:1-(Acetyloxy)-1,2-benziodoxol-3(1H)-one
Description:
1-(Acetyloxy)-1,2-benziodoxol-3(1H)-one, commonly referred to as a benziodoxole derivative, is a chemical compound characterized by its unique structure that includes a benziodoxole ring. This compound typically exhibits properties associated with both electrophilic and nucleophilic reactivity due to the presence of the iodine atom in the benziodoxole moiety. It is often utilized in organic synthesis as a reagent for various transformations, including oxidation reactions. The acetoxy group enhances its reactivity and solubility in organic solvents, making it a valuable intermediate in the synthesis of complex organic molecules. Additionally, this compound may display stability under certain conditions, but it can be sensitive to moisture and light, necessitating careful handling and storage. Its applications extend to medicinal chemistry and materials science, where it can serve as a precursor for the development of pharmaceuticals and functional materials. Overall, 1-(Acetyloxy)-1,2-benziodoxol-3(1H)-one is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C9H7IO4
InChI:InChI=1S/C9H7IO4/c1-6(11)13-10-8-5-3-2-4-7(8)9(12)14-10/h2-5H,1H3
InChI key:InChIKey=XPGGCSZYAKTCKR-UHFFFAOYSA-N
SMILES:O(C(C)=O)I1C=2C(C(=O)O1)=CC=CC2
Synonyms:- 1,2-Benziodoxol-3(1H)-one, 1-(acetyloxy)-
- 3-Oxo-3H-2,1-benzoxiodolium acetate
- 1-(Acetyloxy)-1,2-benziodoxol-3(1H)-one
- 1,2-Benziodoxol-3(1H)-one, 1-acetoxy-
- 1-Acetoxy-1,2-benzoiodoxolin-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Benziodoxol-3(1H)-one, 1-(acetyloxy)-
CAS:Formula:C9H7IO4Purity:97%Color and Shape:SolidMolecular weight:306.05401-Acetoxy-1,2-benziodoxol-3-(1H)-one
CAS:1-Acetoxy-1,2-benziodoxol-3-(1H)-onePurity:98%Molecular weight:306.055g/mol1-(Acetyloxy)-1,2-benziodoxol-3(1H)-one
CAS:Formula:C9H7IO4Purity:>95.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:306.061-Acetoxy-1,2-benziodoxol-3-(1H)-one
CAS:1-Acetoxy-1,2-benziodoxol-3-(1H)-one is a hypervalent amination agent. It is used in the synthesis of complex molecules, such as heterocycles and cyclopropanes. The reaction is mediated by polyvalent metal salts to form a constant ratio of products. This reaction can be carried out in the liquid phase or with aldehydes in the presence of meta-chloroperoxybenzoic acid. The amination reaction is initiated by the addition of an aminating agent such as ammonia or primary alcohols.Formula:C9H7IO4Purity:Min. 95%Color and Shape:PowderMolecular weight:306.05 g/mol




