CAS 1829-34-1
:3-Bromo-2-hydroxybenzaldehyde
Description:
3-Bromo-2-hydroxybenzaldehyde, also known as salicylaldehyde bromide, is an organic compound characterized by its aromatic structure featuring a bromine atom and a hydroxyl group attached to a benzaldehyde moiety. The presence of the hydroxyl group (–OH) contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The bromine substituent enhances electrophilic aromatic substitution reactions, allowing for further functionalization of the aromatic ring. This compound typically appears as a pale yellow to brown solid and is soluble in organic solvents like ethanol and ether, but less so in water due to its hydrophobic aromatic structure. Its melting point and boiling point can vary based on purity and specific conditions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes. Overall, 3-Bromo-2-hydroxybenzaldehyde is a valuable compound in synthetic organic chemistry due to its unique functional groups and reactivity.
Formula:C7H5BrO2
InChI:InChI=1/C7H5BrO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,10H
SMILES:c1cc(C=O)c(c(c1)Br)O
Synonyms:- 3-Bromosalicylaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromosalicylaldehyde
CAS:Formula:C7H5BrO2Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:201.02Benzaldehyde, 3-bromo-2-hydroxy-
CAS:Formula:C7H5BrO2Purity:98%Color and Shape:SolidMolecular weight:201.01743-Bromo-2-hydroxybenzaldehyde
CAS:3-Bromo-2-hydroxybenzaldehydeFormula:C7H5BrO2Purity:98%Color and Shape: faint beige crystalline solidMolecular weight:201.02g/mol3-Bromo-2-hydroxybenzaldehyde
CAS:Formula:C7H5BrO2Purity:95%Color and Shape:SolidMolecular weight:201.0193-Bromosalicylaldehyde
CAS:3-Bromosalicylaldehyde is a white crystalline solid with a melting point of about 130°C. It is soluble in benzene, chloroform, ether, and acetone. 3-Bromosalicylaldehyde has been used as an intermediate for the synthesis of other organic compounds such as piperazine and salicylic acid. The compound is also used to study the inhibitory activity against Staphylococcus aureus. 3-Bromosalicylaldehyde inhibits the growth of S. aureus by binding to its DNA and preventing cell division.
Formula:C7H5BrO2Purity:Min. 95%Color and Shape:SolidMolecular weight:201.02 g/mol




