CymitQuimica logo

CAS 182919-58-0

:

1-BENZYLPIPERIDINE-3-CARBOHYDRAZIDE

Description:
1-Benzylpiperidine-3-carbohydrazide is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a benzyl group enhances its lipophilicity, potentially influencing its biological activity and solubility. The carbohydrazide functional group introduces reactivity, allowing for potential interactions with various biological targets. This compound may exhibit properties typical of piperidine derivatives, such as psychoactive effects or utility in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential applications in the synthesis of more complex molecules or as a building block in drug discovery. The CAS number 182919-58-0 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. As with many organic compounds, its physical and chemical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments and applications. Safety and handling considerations are also crucial, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C13H19N3O
InChI:InChI=1S/C13H19N3O/c14-15-13(17)12-7-4-8-16(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10,14H2,(H,15,17)
InChI key:WUDDEGZXFZWRKR-UHFFFAOYSA-N
SMILES:C1CC(CN(C1)CC2=CC=CC=C2)C(=O)NN
Found 4 products.