CAS 182919-62-6

2-(4-Fluorophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b]benzothiazole-3-carboxaldehyde

Description:

2-(4-Fluorophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b]benzothiazole-3-carboxaldehyde is a complex organic compound characterized by its unique bicyclic structure that combines imidazole and benzothiazole moieties. The presence of a fluorophenyl group enhances its electronic properties, potentially influencing its reactivity and biological activity. This compound features a carboxaldehyde functional group, which is known for its reactivity in various chemical reactions, including condensation and oxidation. The tetrahydro configuration indicates that the compound contains saturated rings, contributing to its stability and solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms and functional groups that can interact with biological targets. Additionally, the fluorine atom may impart unique pharmacokinetic properties, making it a candidate for further research in drug design and synthesis. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, warranting further investigation into its properties and potential applications.

Formula: C₁₆H₁₃FN₂OS

InChI: InChI=1S/C16H13FN2OS/c17-11-7-5-10(6-8-11)15-13(9-20)19-12-3-1-2-4-14(12)21-16(19)18-15/h5-9H,1-4H2

InChI key: InChIKey=TVJOWYKTIBBRBP-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(=NC1C3=CC=C(F)C=C3)SC4=C2CCCC4

Synonyms:

• 2-(4-Fluorophenyl)-5,6,7,8-tetrahydroimidazo[2,1-b]benzothiazole-3-carboxaldehyde
• Imidazo[2,1-b]benzothiazole-3-carboxaldehyde, 2-(4-fluorophenyl)-5,6,7,8-tetrahydro-