
CAS 18293-85-1
:Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethoxy-
Description:
Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethoxy- (CAS 18293-85-1) is a siloxane compound characterized by its unique structure, which includes two silicon atoms connected by oxygen atoms, along with multiple methoxy groups and vinyl groups. This compound typically exhibits properties associated with siloxanes, such as thermal stability, low surface tension, and resistance to moisture. The presence of vinyl groups suggests potential for polymerization, making it useful in applications involving silicone-based materials. The methoxy groups enhance its reactivity and solubility in organic solvents, which can facilitate its use in various chemical reactions and formulations. Additionally, disiloxanes often display low volatility and good adhesion properties, making them suitable for coatings and sealants. Overall, this compound's characteristics make it valuable in the fields of materials science and organic chemistry, particularly in the development of silicone polymers and other advanced materials.
Formula:C8H18O5Si2
InChI:InChI=1S/C8H18O5Si2/c1-7-14(9-3,10-4)13-15(8-2,11-5)12-6/h7-8H,1-2H2,3-6H3
InChI key:InChIKey=KGLJCWSSVJJHRY-UHFFFAOYSA-N
SMILES:[Si](O[Si](C=C)(OC)OC)(C=C)(OC)OC
Synonyms:- Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethoxy-
- 1,3-Divinyl-1,1,3,3-tetramethoxydisiloxane
- Disiloxane, 1,1,3,3-tetramethoxy-1,3-divinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Disiloxane, 1,3-diethenyl-1,1,3,3-tetramethoxy- (9CI)
CAS:Formula:C8H18O5Si2Molecular weight:250.3965
