CAS 1830294-26-2
:Adenosine, N-[2-(methylthio)ethyl]-2-[(3,3,3-trifluoropropyl)thio]-, 2′,3′,5′-triacetate
Description:
Adenosine, N-[2-(methylthio)ethyl]-2-[(3,3,3-trifluoropropyl)thio]-, 2′,3′,5′-triacetate, identified by CAS number 1830294-26-2, is a synthetic derivative of adenosine, a nucleoside composed of adenine and ribose. This compound features modifications that include a methylthioethyl group and a trifluoropropylthio group, which enhance its chemical properties and potential biological activity. The presence of the triacetate moiety indicates that three acetyl groups are attached, which can influence solubility and stability. Generally, compounds like this are studied for their pharmacological properties, particularly in relation to adenosine receptors, which play critical roles in various physiological processes, including neurotransmission and cardiovascular function. The trifluoropropyl group may impart unique interactions with biological targets, potentially leading to novel therapeutic applications. As with many synthetic derivatives, the specific characteristics such as solubility, stability, and reactivity would depend on the molecular structure and the environment in which the compound is studied.
Formula:C22H28F3N5O7S2
InChI:InChI=1S/C22H28F3N5O7S2/c1-11(31)34-9-14-16(35-12(2)32)17(36-13(3)33)20(37-14)30-10-27-15-18(26-6-8-38-4)28-21(29-19(15)30)39-7-5-22(23,24)25/h10,14,16-17,20H,5-9H2,1-4H3,(H,26,28,29)/t14-,16-,17-,20-/m1/s1
InChI key:InChIKey=BHXXFBCYKOTNPY-WVSUBDOOSA-N
SMILES:O(C(C)=O)[C@H]1[C@@H](O[C@H](COC(C)=O)[C@H]1OC(C)=O)N2C=3C(N=C2)=C(NCCSC)N=C(SCCC(F)(F)F)N3
Synonyms:- Adenosine, N-[2-(methylthio)ethyl]-2-[(3,3,3-trifluoropropyl)thio]-, 2′,3′,5′-triacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cangrelor Impurity 4
CAS:Formula:C22H28F3N5O7S2Color and Shape:White To Off-White SolidMolecular weight:595.61N-[2-(Methylthio)ethyl]-2-[(3,3,3-trifluoropropyl)thio]-adenosine 2’,3’,5’-Triacetate
CAS:Controlled ProductApplications N-[2-(Methylthio)ethyl]-2-[(3,3,3-trifluoropropyl)thio]-adenosine 2’,3’,5’-Triacetate is used as a reactant in the synthesis of Cangrelor (C175230).
References Ye, Tianjian, et al.: Zhejiang Yongning Pharmaceutical Co., CN 105949258 A 20160921 (2016);Formula:C22H28F3N5O7S2Color and Shape:NeatMolecular weight:595.612

