
CAS 18312-58-8
:L-Ascorbic acid, ion(1-), 1-carboxy-N,N,N-trimethylmethanaminium
Description:
L-Ascorbic acid, ion(1-), 1-carboxy-N,N,N-trimethylmethanaminium, commonly known as a derivative of vitamin C, is a quaternary ammonium compound characterized by its positive charge due to the trimethylated nitrogen atom. This compound is a salt form of L-ascorbic acid, which is a vital antioxidant known for its role in collagen synthesis, immune function, and as a cofactor in various enzymatic reactions. The presence of the quaternary ammonium group enhances its solubility in water, making it more bioavailable. The structure includes multiple functional groups, such as hydroxyl and carboxyl groups, contributing to its reactivity and ability to participate in redox reactions. This compound is often studied for its potential applications in pharmaceuticals, food preservation, and as a dietary supplement. Its stability and efficacy can be influenced by factors such as pH and temperature, which are critical for maintaining its antioxidant properties. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, highlighting the importance of molecular structure in determining biological activity.
Formula:C6H7O6·C5H12NO2
InChI:InChI=1S/C6H8O6.C5H11NO2/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-6(2,3)4-5(7)8/h2,5,7-10H,1H2;4H2,1-3H3/t2-,5+;/m0./s1
InChI key:InChIKey=GFEOHZQDQDLTSZ-RXSVEWSESA-N
SMILES:C([N+](C)(C)C)C(O)=O.[C@@H](CO)(O)[C@@]1(C(O)=C([O-])C(=O)O1)[H]
Synonyms:- L-Ascorbic acid, ion(1-), 1-carboxy-N,N,N-trimethylmethanaminium
- (Carboxymethyl)trimethylammonium ascorbate
- L-Ascorbic acid, compd. with betaine
- Methanaminium, 1-carboxy-N,N,N-trimethyl-, salt with L-ascorbic acid (1:1)
- Betaine, ascorbate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Betaine L-ascorbate
CAS:Betaine L-ascorbate is a bioactive chemical.Formula:C11H19NO8Color and Shape:SolidMolecular weight:293.27
