CAS 183162-43-8
:1H,1H,12H,12H-Perfluoro-1,12-dodecanediol
Description:
1H,1H,12H,12H-Perfluoro-1,12-dodecanediol, with CAS number 183162-43-8, is a perfluorinated compound characterized by a long carbon chain that is fully fluorinated, except for the hydroxyl groups at both ends. This structure imparts unique properties, including high thermal stability, low surface tension, and excellent chemical resistance. The presence of hydroxyl groups allows for potential hydrogen bonding, which can enhance solubility in certain solvents compared to fully fluorinated compounds. Additionally, the perfluorinated nature of the molecule contributes to its hydrophobic and lipophobic characteristics, making it useful in applications such as surfactants, coatings, and in the formulation of water- and oil-repellent materials. Its environmental persistence and potential bioaccumulation are important considerations, as with many perfluorinated compounds, leading to ongoing research into its safety and regulatory implications. Overall, 1H,1H,12H,12H-Perfluoro-1,12-dodecanediol exemplifies the unique properties of fluorinated compounds, balancing functionality with environmental concerns.
Formula:C12H6F20O2
InChI:InChI=1/C12H6F20O2/c13-3(14,1-33)5(17,18)7(21,22)9(25,26)11(29,30)12(31,32)10(27,28)8(23,24)6(19,20)4(15,16)2-34/h33-34H,1-2H2
SMILES:C(C(C(C(C(C(C(C(C(C(C(CO)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
Synonyms:- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-Icosafluorododecane-1,12-Diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H,1H,12H,12H-Perfluoro-1,12-dodecanediol, tech. 90%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H6F20O2Purity:90%Color and Shape:White, PowderMolecular weight:562.151,12-Dodecanediol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-eicosafluoro-
CAS:Formula:C12H6F20O2Purity:95%Color and Shape:SolidMolecular weight:562.14291H,1H,12H,12H-Perfluoro-1,12-dodecanediol
CAS:Formula:C12H6F20O2Purity:96.0%Color and Shape:SolidMolecular weight:562.1461H,1H,12H,12H-Perfluorododecane-1,12-diol
CAS:1H,1H,12H,12H-Perfluorododecane-1,12-diolFormula:C12H6F20O2Purity:96%Molecular weight:562.14g/mol1H,1H,12H,12H-Icosafluoro-1,12-dodecanediol
CAS:Formula:C12H6F20O2Purity:>96.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:562.15




