CAS 183208-35-7
:5-Bromo-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position enhances its reactivity and can facilitate various substitution reactions. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane. It is often utilized in medicinal chemistry and material science due to its potential biological activity and ability to serve as a building block for more complex molecules. The compound's structure allows for various functionalizations, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, its bromine substituent can be exploited in cross-coupling reactions, further expanding its utility in synthetic organic chemistry. As with many brominated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)
InChI key:InChIKey=LPTVWZSQAIDCEB-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=NC1)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-
- 5-Bromo azaindole
- 5-Bromo-1H-Pyrrolo[2,3-B]Pyridine
- 5-Bromo-1H-pyrrolo2,3-büpyridine
- 5-Bromo-7H-pyrrolo[2,3-b]pyridine
- 5-Bromo-7-azaindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Bromo-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C7H5BrN2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:197.045-Bromo-7-azaindole, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BrN2Purity:96%Molecular weight:197.041H-Pyrrolo[2,3-b]pyridine, 5-bromo-
CAS:Formula:C7H5BrN2Purity:98%Color and Shape:SolidMolecular weight:197.03205-Bromo-7-azaindole
CAS:5-Bromo-7-azaindoleFormula:C7H5BrN2Purity:98%Color and Shape: off white crystalline solidMolecular weight:197.03g/mol5-Bromo-7-azaindole
CAS:5-Bromo-7-azaindole is a nitrogen heterocycle that has shown promising anti-cancer properties. This compound is synthesized by the reaction of sodium azide and 5-bromo-2,4,6-trinitrobenzene in anhydrous conditions. 5-Bromo-7-azaindole displays significant cytotoxicity against human ovarian carcinoma cells in vivo and inhibits the proliferation of cancer cells by binding to ATP synthase. The anticancer activity of this compound is due to its ability to inhibit the synthesis of DNA and RNA, which are vital for cell division. 5-Bromo-7-azaindole also shows an increase in hydrogen bonding, which can be used to explain its structural analysis.
Formula:C7H5BrN2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:197.03 g/mol5-Bromo-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C7H5BrN2Purity:95%Color and Shape:Light yellow powderMolecular weight:197.035







