CAS 18325-45-6
:2-(trityloxy)ethanol
Description:
2-(Trityloxy)ethanol, with the CAS number 18325-45-6, is an organic compound characterized by the presence of a trityloxy group attached to an ethanol backbone. The trityloxy group, derived from triphenylmethanol, imparts significant hydrophobic characteristics to the molecule, making it less soluble in water compared to simple alcohols. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits properties common to alcohols, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. The presence of the trityl group also enhances its stability and can provide steric hindrance, affecting its reactivity in chemical reactions. 2-(Trityloxy)ethanol is often utilized in organic synthesis and as a protecting group in carbohydrate chemistry, where it serves to shield hydroxyl groups during various chemical transformations. Its unique structure and properties make it a valuable compound in both academic research and industrial applications.
Formula:C21H20O2
InChI:InChI=1/C21H20O2/c22-16-17-23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,22H,16-17H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)OCCO
Synonyms:- Ethanol, 2-(triphenylmethoxy)-
- 2-(Trityloxy)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
