CAS 183266-61-7

1-Trifluoromethylacetylbenzotriazole

Description:

1-Trifluoromethylacetylbenzotriazole is an organic compound characterized by its unique structure, which includes a benzotriazole moiety substituted with a trifluoromethyl group and an acetyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the trifluoromethyl group, which can influence its electronic properties and lipophilicity. The benzotriazole ring contributes to its ability to act as a UV stabilizer and corrosion inhibitor in various applications. Additionally, the presence of the acetyl group may enhance its solubility in organic solvents, making it useful in formulations. The trifluoromethyl group is known for imparting unique characteristics such as increased metabolic stability and altered biological activity. Overall, 1-Trifluoromethylacetylbenzotriazole is of interest in fields such as materials science, pharmaceuticals, and agrochemicals due to its functional properties and potential applications.

Formula: C₈H₄F₃N₃O

InChI: InChI=1/C8H4F3N3O/c9-8(10,11)7(15)14-6-4-2-1-3-5(6)12-13-14/h1-4H

SMILES: c1ccc2c(c1)nnn2C(=O)C(F)(F)F

Synonyms:

• 1-(trifluoroacetyl)-1H-benzotriazole

(Trifluoroacetyl)benzotriazole (mixture of 1H- and 2H- isomers)

CAS: 183266-61-7

Formula: C₈H₄F₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.1321

Ref: IN-DA00ALAO

1-(1H-Benzo[D][1,2,3]Triazol-1-Yl)-2,2,2-Trifluoroethanone

CAS: 183266-61-7

1-(1H-Benzo[D][1,2,3]Triazol-1-Yl)-2,2,2-Trifluoroethanone

Purity: 98%

Molecular weight: 215.13g/mol

Ref: 54-PC109235

(Trifluoroacetyl)benzotriazole (mixture of 1H- and 2H- isomers)

CAS: 183266-61-7

Formula: C₈H₄F₃N₃O

Purity: >98.0%(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 215.14

Ref: 3B-T3174