CAS 18327-72-5
:Titanium methacrylate triisopropoxide
Description:
Titanium methacrylate triisopropoxide, with the CAS number 18327-72-5, is an organometallic compound that features a titanium center coordinated with methacrylate and isopropoxide ligands. This compound typically exhibits characteristics common to titanium alkoxides, such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly in polymerization processes, where it can act as a catalyst or a precursor for titanium-based materials. The presence of methacrylate groups allows for potential applications in the synthesis of polymers and composites, especially in the field of coatings and adhesives. Additionally, the isopropoxide groups contribute to its solubility in organic solvents, enhancing its utility in various chemical reactions. Due to its reactivity, handling precautions are necessary, as it may hydrolyze in the presence of moisture, releasing isopropanol and forming titanium oxo species. Overall, titanium methacrylate triisopropoxide is valued in materials science for its versatility and functional properties.
Formula:C13H26O5Ti
InChI:InChI=1/C4H6O2.3C3H7O.Ti/c1-3(2)4(5)6;3*1-3(2)4;/h1H2,2H3,(H,5,6);3*3H,1-2H3;/q;3*-1;+4/p-1/rC13H26O5Ti/c1-9(2)13(14)18-19(15-10(3)4,16-11(5)6)17-12(7)8/h10-12H,1H2,2-8H3
SMILES:C=C(C)C(=O)O.CC(C)[O-].CC(C)[O-].CC(C)[O-].[Ti]
Synonyms:- Triisopropoxy(2-Methylprop-2-Enoyloxy)Titanium
- TITANIUM METHACRYLATE TRIISOPROPOXIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Titanium, (2-methyl-2-propenoato-κO)tris(2-propanolato)-, (T-4)-
CAS:Formula:C13H26O5TiMolecular weight:310.2095
