CAS 183274-50-2

3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine

Description:

3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a bromine atom and an isopropoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can influence its reactivity and interaction with biological targets, while the isopropoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. The compound's structure suggests potential applications in areas such as cancer research or as a kinase inhibitor, given the role of pyrazolo-pyrimidines in various biological pathways. Additionally, its molecular stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic system. Overall, 3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine represents a valuable scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₈H₁₀BrN₅O

InChI: InChI=1S/C8H10BrN5O/c1-3(2)15-7-4-5(9)13-14-6(4)11-8(10)12-7/h3H,1-2H3,(H3,10,11,12,13,14)

SMILES: CC(C)Oc1c2c(Br)[nH][nH]c2nc(=N)n1

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidin-6-amine, 3-bromo-4-(1-methylethoxy)-

3-Bromo-4-isopropoxy-1H-pyrazolo[3,4-d]pyrimidin-6-amine

CAS: 183274-50-2

Formula: C₈H₁₀BrN₅O

Molecular weight: 272.1019

Ref: IN-DA0027GS

3-Bromo-4-(propan-2-yloxy)-1H-pyrazolo[3,4-d]pyrimidin-6-amine

CAS: 183274-50-2

3-Bromo-4-(propan-2-yloxy)-1H-pyrazolo[3,4-d]pyrimidin-6-amine

Purity: ≥95%

Molecular weight: 272.10g/mol

Ref: 54-OR305360