CAS 183293-82-5

6-(5-carboxy-5-methyl-hexoxy)-2,2-dimethyl-hexanoic acid

Description:

6-(5-Carboxy-5-methyl-hexoxy)-2,2-dimethyl-hexanoic acid, with the CAS number 183293-82-5, is a complex organic compound characterized by its carboxylic acid functional group and a branched hydrocarbon chain. This substance features a hexanoic acid backbone, which contributes to its hydrophobic properties, while the presence of the carboxylic acid group imparts acidity and potential for solubility in polar solvents. The molecule's structure includes multiple methyl groups, which can influence its steric hindrance and overall reactivity. Additionally, the presence of the hexoxy chain enhances its potential for interactions with biological systems, making it of interest in various applications, including pharmaceuticals and materials science. Its unique combination of functional groups may also allow for specific binding interactions or modifications, which can be leveraged in synthetic chemistry or drug design. Overall, this compound exemplifies the complexity and versatility found in organic chemistry, particularly in the design of molecules with tailored properties for specific applications.

Formula: C₁₆H₃₀O₅

InChI: InChI=1/C16H30O5/c1-15(2,13(17)18)9-5-7-11-21-12-8-6-10-16(3,4)14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20)

SMILES: CC(C)(CCCCOCCCCC(C)(C)C(=O)O)C(=O)O

Synonyms:

• Gemcabene
• 6,6'-Oxybis(2,2-Dimethylhexanoic Acid)
• 6-(5-carboxy-5-methyl-hexyloxy)-2,2-dimethyl-hexanoic acid
• 6-(5-carboxy-5-methyl-hexoxy)-2,2-dimethyl-hexanoic acid
• PD-72953
• Hexanoic acid, 6,6'-oxybis[2,2-dimethyl-

Hexanoic acid, 6,6'-oxybis[2,2-dimethyl-

CAS: 183293-82-5

Formula: C₁₆H₃₀O₅

Purity: 95%

Molecular weight: 302.4064

Ref: IN-DA0027HB

Gemcabene

CAS: 183293-82-5

Gemcabene

Purity: ≥98%

Molecular weight: 302.41g/mol

Ref: 54-BUP02147

Gemcabene

CAS: 183293-82-5

Gemcabene (PD-72953) lowers LDL and triglycerides, boosts HDL, and reduces inflammation by decreasing C-reactive protein.

Formula: C₁₆H₃₀O₅

Purity: ≥98%

Color and Shape: Solid

Molecular weight: 302.41

Ref: TM-T11386L