CAS 183298-93-3: Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate

Description:Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate is a heterocyclic organic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a methyl group and a carboxylate functional group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The thiadiazole ring is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in chemical reactions and formulations. The compound's structure allows for various substitution reactions, making it versatile for synthesizing other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula:C₅H₆N₂O₂S

InChI:InChI=1S/C5H6N2O2S/c1-3-4(5(8)9-2)10-7-6-3/h1-2H3

InChI key:InChIKey=DHWHVXWZHNDIDB-UHFFFAOYSA-N

SMILES:O=C(OC)C=1SN=NC1C

Synonyms:
1,2,3-Thiadiazole-5-carboxylic acid, 4-methyl-, methyl ester
4-Methyl-1,2,3-thiadiazole-5-carboxylic acid methyl ester
Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate REF: 10-F042376CAS: 183298-93-3	95.0%	- - -	Discontinued product
	Methyl 4-methyl-1,2,3-thiadiazole-5-carboxylate REF: 3D-IHA29893CAS: 183298-93-3	Min. 95%	- - -	Discontinued product