CAS 1833-31-4: [(Chlorodimethylsilyl)methyl]benzene
Description:[(Chlorodimethylsilyl)methyl]benzene, with the CAS number 1833-31-4, is an organosilicon compound characterized by the presence of a chlorodimethylsilyl group attached to a methylbenzene (toluene) structure. This compound typically exhibits a clear to pale yellow liquid form and has a distinctive aromatic odor due to the benzene ring. It is known for its reactivity, particularly in nucleophilic substitution reactions, where the chlorosilane group can participate in various chemical transformations. The presence of the silicon atom imparts unique properties, such as enhanced thermal stability and potential applications in silicone polymer synthesis. Additionally, the compound may exhibit moderate volatility and solubility in organic solvents, making it useful in various chemical processes, including as a reagent in organic synthesis and as a precursor in the production of siloxane materials. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chlorinated nature and potential irritant properties.
Formula:C9H13ClSi
InChI:InChI=1S/C9H13ClSi/c1-11(2,10)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3
InChI key:InChIKey=ABHNFDUSOVXXOA-UHFFFAOYSA-N
SMILES:Cl[Si](C)(C)CC=1C=CC=CC1
- Synonyms:
- Benzene, ((chlorodimethylsilyl)methyl)-
- Benzylchlorodimethylsilane
- Benzyldimethylsilyl chloride
- Brn 2935456
- Phenylmethylchlorodimethylsilane
- Silane, benzylchlorodimethyl-
- Silane, chlorodimethyl(phenylmethyl)-
- [(Chlorodimethylsilyl)methyl]benzene
- Benzyldimethylchlorosilane
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzylchlorodimethylsilane REF: 3B-B2334CAS: 1833-31-4 | >98.0%(GC) | 173.00 € | Thu 10 Apr 25 |
![]() | Benzene, [(chlorodimethylsilyl)methyl]- REF: IN-DA0027HNCAS: 1833-31-4 | 98% | 33.00 €~358.00 € | Thu 17 Apr 25 |
![]() | Benzylchlorodimethylsilane REF: 54-OR1024544CAS: 1833-31-4 | - - - | 34.00 €~1,616.00 € | Mon 21 Apr 25 |
![]() | Benzyldimethylchlorosilane REF: 10-S00950CAS: 1833-31-4 | 95% | To inquire | Tue 29 Apr 25 |
![]() | Benzylchlorodimethylsilane REF: 3D-FB61079CAS: 1833-31-4 | Min. 95% | - - - | Discontinued product |

Benzylchlorodimethylsilane
Ref: 3B-B2334
5g | 173.00 € |

Benzene, [(chlorodimethylsilyl)methyl]-
Ref: IN-DA0027HN
1g | 33.00 € | ||
5g | 56.00 € | ||
25g | 126.00 € | ||
100g | 345.00 € |

Ref: 54-OR1024544
5g | 34.00 € | ||
25g | 119.00 € | ||
100g | 378.00 € | ||
500g | 1,616.00 € |

Benzyldimethylchlorosilane
Ref: 10-S00950
100g | To inquire |

Benzylchlorodimethylsilane
Ref: 3D-FB61079
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |