CAS 1833-53-0: Trimethyl[(1-methylethenyl)oxy]silane
Description:Trimethyl[(1-methylethenyl)oxy]silane, with the CAS number 1833-53-0, is an organosilicon compound characterized by the presence of a silicon atom bonded to three methyl groups and an alkoxy group derived from 1-methylethenol. This compound typically appears as a colorless liquid and is known for its low viscosity and volatility. It exhibits properties common to silanes, such as reactivity with moisture, which can lead to the formation of silanol groups upon hydrolysis. Trimethyl[(1-methylethenyl)oxy]silane is often utilized in the synthesis of silicone polymers and as a coupling agent in various chemical reactions, enhancing adhesion and compatibility between organic and inorganic materials. Its unique structure allows for potential applications in coatings, sealants, and as a precursor in the production of functionalized silanes. Additionally, it may exhibit some degree of hydrophobicity due to the presence of the silane group, making it useful in applications requiring water repellency. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H14OSi
InChI:InChI=1S/C6H14OSi/c1-6(2)7-8(3,4)5/h1H2,2-5H3
InChI key:InChIKey=UAIFZYSPVVBOPN-UHFFFAOYSA-N
SMILES:O(C(=C)C)[Si](C)(C)C
- Synonyms:
- (Isopropenyloxy)trimethylsilane
- 2-(Trimethylsiloxy)propene
- 2-(Trimethylsilyloxy)-1-propene
- 2-(Trimethylsilyloxy)propene
- 2-Trimethylsiloxy-1-propene
- Acetone trimethylsilyl enol ether
- Isopropenoxytrimethylsilane
- Isopropenyl trimethylsilyl ether
- Silane, (isopropenyloxy)trimethyl-
- Silane, trimethyl[(1-methylethenyl)oxy]-
- See more synonyms
- Trimethyl(Prop-1-En-2-Yloxy)Silane
- Trimethyl[(1-methylethenyl)oxy]silane
- Trimethyl[(1-methylvinyl)oxy]silane

Isopropenyloxytrimethylsilane [Trimethylsilylating Agent]
Ref: 3B-I0324
5ml | 119.00 € |

Isopropenyloxytrimethylsilane (2-Trimethylsiloxypropene)
Ref: 10-S10250
1g | 102.00 € | ||
5g | 289.00 € | ||
25g | 914.00 € | ||
250mg | 45.00 € |

Silane, trimethyl[(1-methylethenyl)oxy]-
Ref: IN-DA0027HJ
1g | 97.00 € | ||
5g | 204.00 € | ||
25g | 615.00 € | ||
250mg | 46.00 € |

Isopropenyloxytrimethylsilane
Ref: 54-OR941580
1g | 82.00 € | ||
5g | 188.00 € |

Isopropenyloxytrimethylsilane
Ref: 3D-FI61104
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |