CAS 183302-79-6

1,2,3-Thiadiazole-5-carboxylicacid,4-(1-methylethyl)-,ethylester(9CI)

Description:

1,2,3-Thiadiazole-5-carboxylic acid, 4-(1-methylethyl)-, ethyl ester, with the CAS number 183302-79-6, is a chemical compound characterized by its thiadiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its potential reactivity and solubility properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, which may influence its biological activity and interaction with other substances. Thiadiazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science due to their ability to act as intermediates or active compounds. The specific esterification of the carboxylic acid can affect the compound's stability and reactivity, making it of interest for various synthetic and medicinal chemistry applications. Overall, this compound exemplifies the complexity and utility of heterocyclic compounds in chemical research and development.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1/C8H12N2O2S/c1-4-12-8(11)7-6(5(2)3)9-10-13-7/h5H,4H2,1-3H3

SMILES: CCOC(=O)c1c(C(C)C)nns1

ethyl 4-(propan-2-yl)-1,2,3-thiadiazole-5-carboxylate

CAS: 183302-79-6

Formula: C₈H₁₂N₂O₂S

Purity: 97%

Molecular weight: 200.2581

Ref: IN-DA00AE33