CAS 183320-04-9

4-Quinazolinamine, 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-, hydrochloride (1:1)

Description:

4-Quinazolinamine, 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-, hydrochloride (1:1) is a synthetic organic compound characterized by its quinazoline core structure, which is known for its diverse biological activities. The presence of various functional groups, such as the chloroethoxy and methoxyethoxy moieties, contributes to its potential pharmacological properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for many hydrochloride salts. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. The compound's CAS number, 183320-04-9, allows for precise identification and retrieval of information in chemical databases. As with many quinazoline derivatives, it may exhibit properties such as anti-cancer, anti-inflammatory, or anti-viral activities, although specific biological data would be necessary to confirm these effects. Proper handling and storage conditions should be observed due to its classification as a hydrochloride salt.

Formula: C₂₁H₂₀ClN₃O₃·ClH

InChI: InChI=1S/C21H20ClN3O3.ClH/c1-3-15-5-4-6-16(11-15)25-21-17-12-19(27-8-7-22)20(28-10-9-26-2)13-18(17)23-14-24-21;/h1,4-6,11-14H,7-10H2,2H3,(H,23,24,25);1H

InChI key: InChIKey=NQFZBXSVTMDWFQ-UHFFFAOYSA-N

SMILES: N(C=1C2=C(C=C(OCCOC)C(OCCCl)=C2)N=CN1)C3=CC(C#C)=CC=C3.Cl

Synonyms:

• 4-Quinazolinamine, 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-, hydrochloride (1:1)
• 4-Quinazolinamine, 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-, monohydrochloride