CAS 183320-19-6
:4-Quinazolinamine, 7-(2-chloroethoxy)-N-(3-ethynylphenyl)-6-(2-methoxyethoxy)-, hydrochloride (1:1)
Description:
4-Quinazolinamine, 7-(2-chloroethoxy)-N-(3-ethynylphenyl)-6-(2-methoxyethoxy)-, hydrochloride (1:1) is a synthetic organic compound characterized by its quinazoline core structure, which is known for its diverse biological activities. The presence of various functional groups, such as the chloroethoxy and methoxyethoxy substituents, contributes to its potential pharmacological properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments, which is advantageous for biological assays and formulations. The ethynylphenyl moiety suggests potential interactions with biological targets, possibly influencing its activity in medicinal chemistry. The compound's molecular structure indicates it may exhibit properties such as anti-cancer, anti-inflammatory, or antimicrobial activities, although specific biological effects would require empirical investigation. As with many quinazoline derivatives, it may also serve as a scaffold for further chemical modifications aimed at optimizing its therapeutic efficacy. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C21H20ClN3O3·ClH
InChI:InChI=1S/C21H20ClN3O3.ClH/c1-3-15-5-4-6-16(11-15)25-21-17-12-19(28-10-9-26-2)20(27-8-7-22)13-18(17)23-14-24-21;/h1,4-6,11-14H,7-10H2,2H3,(H,23,24,25);1H
InChI key:InChIKey=GBQJODHTQRFZEL-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(OCCCl)C(OCCOC)=C2)N=CN1)C3=CC(C#C)=CC=C3.Cl
Synonyms:- 4-Quinazolinamine, 7-(2-chloroethoxy)-N-(3-ethynylphenyl)-6-(2-methoxyethoxy)-, hydrochloride (1:1)
- 4-Quinazolinamine, 7-(2-chloroethoxy)-N-(3-ethynylphenyl)-6-(2-methoxyethoxy)-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
