CAS 183322-20-5
:4-Chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)quinazoline
Description:
4-Chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)quinazoline is a synthetic organic compound belonging to the quinazoline class, which is characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features multiple substituents, including chlorine and ether groups, which can influence its chemical reactivity and biological activity. The presence of the chloroethoxy and methoxyethoxy groups suggests potential for solubility in organic solvents and may enhance its pharmacological properties. Quinazoline derivatives are often studied for their potential as pharmaceuticals, particularly in the fields of oncology and anti-inflammatory therapies. The specific arrangement of substituents in this compound may affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for its practical applications and formulation in drug development. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H14Cl2N2O3
InChI:InChI=1S/C13H14Cl2N2O3/c1-18-4-5-20-11-6-9-10(16-8-17-13(9)15)7-12(11)19-3-2-14/h6-8H,2-5H2,1H3
InChI key:InChIKey=HFGVHQGBDDTDIJ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(OCCCl)C(OCCOC)=C2)N=CN1
Synonyms:- 4-Chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)quinazoline
- Quinazoline, 4-chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
4-Chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)quinazoline
CAS:Formula:C13H14Cl2N2O3Color and Shape:SolidMolecular weight:317.16794-Chloro-7-(2-chloroethoxy)-6-(2-methoxyethoxy)quinazoline
CAS:Controlled ProductFormula:C13H14Cl2N2O3Color and Shape:NeatMolecular weight:317.17



