CAS 183322-47-6

7-Quinazolinecarboxylic acid, 4-chloro-, methyl ester

Description:

7-Quinazolinecarboxylic acid, 4-chloro-, methyl ester is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, as indicated by the "methyl ester" designation. The presence of a chlorine atom at the 4-position of the quinazoline ring contributes to its unique reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making them of interest in medicinal chemistry. The molecular structure allows for various interactions with biological targets, which can be explored in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of study in both synthetic and pharmaceutical chemistry. Its CAS number, 183322-47-6, provides a unique identifier for regulatory and research purposes.

Formula: C₁₀H₇ClN₂O₂

InChI: InChI=1/C10H7ClN2O2/c1-15-10(14)6-2-3-7-8(4-6)12-5-13-9(7)11/h2-5H,1H3

SMILES: COC(=O)c1ccc2c(c1)ncnc2Cl

Synonyms:

• Methyl 4-Chloroquinazoline-7-Carboxylate

7-Quinazolinecarboxylic acid, 4-chloro-, methyl ester

CAS: 183322-47-6

Formula: C₁₀H₇ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.6278

Ref: IN-DA0027IN

Methyl 4-chloroquinazoline-7-carboxylate

CAS: 183322-47-6

Methyl 4-chloroquinazoline-7-carboxylate

Purity: 98%

Molecular weight: 222.63g/mol

Ref: 54-OR1035978

Methyl 4-chloroquinazoline-7-carboxylate

CAS: 183322-47-6

Formula: C₁₀H₇ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 222.63

Ref: 10-F076934