CAS 18339-94-1: 2,2-Dimethyl-1,3,6,9-tetraoxa-2-silacycloundecane
Description:2,2-Dimethyl-1,3,6,9-tetraoxa-2-silacycloundecane, with CAS number 18339-94-1, is a cyclic siloxane compound characterized by its unique structure that incorporates both silicon and oxygen atoms within a cyclic framework. This compound features a silacycloundecane ring, which consists of a total of eleven atoms, including four oxygen atoms and one silicon atom, interspersed with carbon atoms. The presence of the dimethyl groups contributes to its steric properties and can influence its reactivity and solubility. Generally, compounds of this nature exhibit interesting chemical behavior, including potential applications in materials science, particularly in the development of polymers and coatings due to their stability and unique mechanical properties. Additionally, the oxygen atoms in the structure can enhance the compound's polarity and solubility in various solvents. Overall, 2,2-Dimethyl-1,3,6,9-tetraoxa-2-silacycloundecane represents a fascinating example of organosilicon chemistry with potential utility in various industrial applications.
Formula:C8H18O4Si
InChI:InChI=1S/C8H18O4Si/c1-13(2)11-7-5-9-3-4-10-6-8-12-13/h3-8H2,1-2H3
InChI key:InChIKey=UXWKDYXFUUBISW-UHFFFAOYSA-N
SMILES:O1CCOCCO[Si](OCC1)(C)C
- Synonyms:
- 1,3,6,9-Tetraoxa-2-silacycloundecane, 2,2-dimethyl-
- 2,2-Dimethyl-1,3,6,9-Tetraoxa-2-Silacycloundecane
- Dimethylsilacrownphasetransfercatalyst
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,3,6,9-Tetraoxa-2-silacycloundecane, 2,2-dimethyl- REF: IN-DA0027JJCAS: 18339-94-1 | - - - | To inquire | Wed 16 Apr 25 |
![]() | DIMETHYLSILA-11-CROWN-4, 95% REF: 3H-SID4220.4CAS: 18339-94-1 | 95% | To inquire | Tue 29 Apr 25 |
![]() | 1,1-Dimethylsila-11-crown-4 REF: 10-S07400CAS: 18339-94-1 | 98% | - - - | Discontinued product |

1,3,6,9-Tetraoxa-2-silacycloundecane, 2,2-dimethyl-
Ref: IN-DA0027JJ
Undefined size | To inquire |

DIMETHYLSILA-11-CROWN-4, 95%
Ref: 3H-SID4220.4
25g | To inquire |

1,1-Dimethylsila-11-crown-4
Ref: 10-S07400
25g | Discontinued | Request information |