CAS 18339-98-5
:Methylbis(trimethylsilyl)phosphine
Description:
Methylbis(trimethylsilyl)phosphine, with the CAS number 18339-98-5, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two trimethylsilyl groups and one methyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents, which makes it useful in various chemical applications, particularly in the synthesis of organophosphorus compounds. The presence of the trimethylsilyl groups enhances its stability and reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal centers. Methylbis(trimethylsilyl)phosphine is also of interest in the field of materials science and catalysis due to its potential as a precursor for the synthesis of silicon-containing materials. However, it should be handled with care, as it may pose health risks upon exposure, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C7H21PSi2
InChI:InChI=1S/C7H21PSi2/c1-8(9(2,3)4)10(5,6)7/h1-7H3
InChI key:InChIKey=SIRIKYUWKQNSPQ-UHFFFAOYSA-N
SMILES:P([Si](C)(C)C)([Si](C)(C)C)C
Synonyms:- Methylbis(trimethylsilyl)phosphine
- Phosphine, methylbis(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
