CAS 1834-27-1

6-chloro-4-methyl-2H-pyridazin-3-one

Description:

6-Chloro-4-methyl-2H-pyridazin-3-one is a heterocyclic organic compound characterized by its pyridazine ring structure, which is a six-membered ring containing two nitrogen atoms at the 1 and 2 positions. This compound features a chlorine atom at the 6-position and a methyl group at the 4-position, contributing to its unique chemical properties. It is typically a crystalline solid and is soluble in polar organic solvents. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which is often explored in medicinal chemistry for potential therapeutic uses. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.

Formula: C₅H₅ClN₂O

InChI: InChI=1/C5H5ClN2O/c1-3-2-4(6)7-8-5(3)9/h2H,1H3,(H,8,9)

SMILES: Cc1cc(Cl)nnc1O

Synonyms:

• 3(2H)-Pyridazinone, 6-chloro-4-methyl- (9CI)
• Nsc 113474
• 6-chloro-4-methylpyridazin-3(2H)-one

6-Chloro-4-methylpyridazin-3-ol

CAS: 1834-27-1

Formula: C₅H₅ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 144.5590

Ref: IN-DA0027JR

6-Chloro-4-methylpyridazin-3(2H)-one

CAS: 1834-27-1

Formula: C₅H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 144.56

Ref: 10-F238616

6-Chloro-3-hydroxy-4-methylpyridazine

CAS: 1834-27-1

6-Chloro-3-hydroxy-4-methylpyridazine

Purity: 99%

Color and Shape: Solid

Molecular weight: 144.56g/mol

Ref: 54-OR304305