CAS 18342-97-7
:3-Hydroxypyridine-4-carboxylic acid ethyl ester
Description:
3-Hydroxypyridine-4-carboxylic acid ethyl ester, with the CAS number 18342-97-7, is an organic compound characterized by its pyridine ring structure, which features a hydroxyl group and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone but may have limited solubility in water due to the hydrophobic nature of the ethyl ester group. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its chemical properties, such as acidity and reactivity, can be influenced by the substituents on the pyridine ring, making it a versatile compound in chemical research and development. Safety data should be consulted for handling and usage guidelines.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-2-12-8(11)6-3-4-9-5-7(6)10/h3-5,10H,2H2,1H3
Synonyms:- Ethyl 3-hydroxyisonicotinate
- Ethyl 3-Hydroxypyridine-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Hydroxypyridine-4-carboxylic acid ethyl ester
CAS:Formula:C8H9NO3Purity:98%Color and Shape:SolidMolecular weight:167.1620Ethyl 3-hydroxyisonicotinate
CAS:Ethyl 3-hydroxyisonicotinate
Color and Shape:SolidMolecular weight:167.16g/molEthyl 3-hydroxyisonicotinate
CAS:Formula:C8H9NO3Purity:98%Color and Shape:SolidMolecular weight:167.164


