CAS 183428-90-2
:6-AMINO-2-METHYLNICOTINONITRILE
Description:
6-Amino-2-methylnicotinonitrile, with the CAS number 183428-90-2, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with an amino group and a nitrile group, which contributes to its unique chemical properties. The presence of the amino group typically imparts basic characteristics, while the nitrile group can enhance the compound's reactivity and polarity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to biologically active molecules. It may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. Additionally, its solubility and stability can vary based on environmental conditions such as pH and temperature. As with many chemical substances, proper handling and safety precautions are essential, given the potential hazards associated with its use in laboratory settings.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c1-5-6(4-8)2-3-7(9)10-5/h2-3H,1H3,(H2,9,10)
SMILES:Cc1c(ccc(=N)[nH]1)C#N
Synonyms:- 6-Amino-3-Cyano-2-Methylpyridine
- 6-Amino-2-Methylpyridine-3-Carbonitrile, 97%
- 6-Amino-3-cyano-2-methylpyridine 97%
- 3-Pyridinecarbonitrile,6-amino-2-methyl-(9CI)
- 6-Amino-2-Methylpyridine-3-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Amino-3-cyano-2-methylpyridine, 97%
CAS:6-Amino-3-cyano-2-methylpyridine is a useful nitrile building block for proteomics research and synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original AlfaFormula:C7H7N3Purity:97%Color and Shape:Pale yellow to yellow to pale brown, PowderMolecular weight:133.153-Pyridinecarbonitrile, 6-amino-2-methyl-
CAS:Formula:C7H7N3Purity:97%Color and Shape:SolidMolecular weight:133.15066-Amino-3-cyano-2-methylpyridine
CAS:6-Amino-3-cyano-2-methylpyridinePurity:95%Molecular weight:133.15g/mol




