CAS 183483-15-0

4-(8-Chloro-5,6-dihydro-3-hydroxy-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic Acid Ethyl Ester

Description:

4-(8-Chloro-5,6-dihydro-3-hydroxy-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic Acid Ethyl Ester, with CAS number 183483-15-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzo[5,6]cyclohepta[1,2-b]pyridine moiety. This compound features a chloro substituent and a hydroxyl group, contributing to its potential biological activity. The presence of the ethyl ester functional group suggests that it may exhibit lipophilic properties, which can influence its solubility and permeability in biological systems. The compound's unique structural features may allow it to interact with specific biological targets, making it of interest in medicinal chemistry and pharmacology. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation into its biological effects and mechanisms of action.

Formula: C₂₂H₂₃ClN₂O₃

InChI: InChI=1/C22H23ClN2O3/c1-2-28-22(27)25-9-7-14(8-10-25)20-19-6-5-17(23)11-15(19)3-4-16-12-18(26)13-24-21(16)20/h5-6,11-13,26H,2-4,7-10H2,1H3

SMILES: CCOC(=O)N1CCC(=C2c3ccc(cc3CCc3cc(cnc23)O)Cl)CC1

Synonyms:

• 3-Hydroxy Loratadine

Ethyl 4-(8-chloro-5,6-dihydro-3-hydroxy-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate

CAS: 183483-15-0

Formula: C₂₂H₂₃ClN₂O₃

Color and Shape: Solid

Molecular weight: 398.8826

Ref: IN-DA0027M7

3-Hydroxy Loratadine

CAS: 183483-15-0

Formula: C₂₂H₂₃ClN₂O₃

Molecular weight: 398.89

Ref: 4Z-L-1063

3-Hydroxy Loratadine

Controlled Product

CAS: 183483-15-0

Applications An intermediate for the preparation of 3-Hydroxy Desloratadine.

Formula: C₂₂H₂₃ClN₂O₃

Color and Shape: Neat

Molecular weight: 398.88

Ref: TR-H943870

3-Hydroxy loratadine

CAS: 183483-15-0

Loratadine is a nonsteroidal antihistamine that competitively blocks histamine H1 receptors in the brain, which decreases the allergic response. It also has glucuronide metabolites, which are eliminated by the kidney and can be measured in the plasma concentration. Loratadine's time-dependent effect on histamine release is due to its ability to block histamine H1 receptors for up to 12 hours after administration. Loratadine has been shown to have an antagonistic effect on clopidogrel, meaning it prevents the drug from working properly by blocking its action at the H1 receptor. This interaction could result in increased risk of adverse events, such as heart attack or stroke.

Formula: C₂₂H₂₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 398.88 g/mol

Ref: 3D-FH24030

3-Hydroxy Loratadine

CAS: 183483-15-0

Formula: C₂₂H₂₃ClN₂O₃

Molecular weight: 398.89

Ref: ST-EA-CP-L5023