CymitQuimica logo

CAS 18349-09-2

:

2-Bromo-6-fluoro-4-methylbenzenamine

Description:
2-Bromo-6-fluoro-4-methylbenzenamine, with the CAS number 18349-09-2, is an organic compound that belongs to the class of aromatic amines. It features a benzene ring substituted with a bromine atom at the 2-position, a fluorine atom at the 6-position, and a methyl group at the 4-position, along with an amino group (-NH2) that is directly attached to the benzene ring. This compound is characterized by its relatively low molecular weight and specific functional groups that contribute to its reactivity and potential applications in organic synthesis. The presence of halogen substituents (bromine and fluorine) can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's solubility and interaction with other molecules. Overall, 2-Bromo-6-fluoro-4-methylbenzenamine is of interest in fields such as pharmaceuticals and materials science due to its unique structural features.
Formula:C7H7BrFN
InChI:InChI=1S/C7H7BrFN/c1-4-2-5(8)7(10)6(9)3-4/h2-3H,10H2,1H3
InChI key:InChIKey=QVECFWRRZNGQDO-UHFFFAOYSA-N
SMILES:NC1=C(Br)C=C(C)C=C1F
Synonyms:
  • 2-Bromo-6-fluoro-4-methylbenzenamine
  • Benzenamine, 2-bromo-6-fluoro-4-methyl-
  • p-Toluidine, 2-bromo-6-fluoro-
  • 2-Bromo-6-fluoro-4-methylaniline
Found 4 products.