CAS 1835-04-7
:Propioveratrone
Description:
Propioveratrone, with the CAS number 1835-04-7, is a chemical compound that belongs to the class of veratrum alkaloids. It is characterized by its unique molecular structure, which includes a propyl group and a veratrole moiety. This compound is typically a white to off-white solid and is known for its potential biological activities, including effects on the cardiovascular system. Propioveratrone has been studied for its pharmacological properties, particularly its role as a vasodilator and its influence on blood pressure regulation. Its solubility characteristics can vary, often being more soluble in organic solvents than in water. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Research into its applications and mechanisms of action continues, contributing to the understanding of its potential therapeutic uses.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-4-9(12)8-5-6-10(13-2)11(7-8)14-3/h5-7H,4H2,1-3H3
InChI key:InChIKey=SBMSBQOMJGZBRY-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C(CC)=O)=C1
Synonyms:- 1,2-Dimethoxy-4-propionylbenzene
- 1-(3,4-Dimethoxyphenyl)-1-propanone
- 1-Propanone, 1-(3,4-dimethoxyphenyl)-
- 3',4'-Dimethoxy-1-Phenylpropiophenone
- 3,4-Dimethoxyphenyl ethyl ketone
- 3,4-Dimethoxypropiophenone
- Ethyl 3,4-dimethoxyphenyl ketone
- Nsc 16954
- Propiophenone, 3′,4′-dimethoxy-
- Propioveratrone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(3,4-Dimethoxy-phenyl)-propan-1-one
CAS:Formula:C11H14O3Purity:95%Color and Shape:SolidMolecular weight:194.22711-(3,4-Dimethoxyphenyl)propan-1-one
CAS:<p>1-(3,4-Dimethoxyphenyl)propan-1-one</p>Purity:95%Molecular weight:194.23g/mol3,4-Dimethoxypropiophenone
CAS:<p>3,4-Dimethoxypropiophenone is a superacidic electrophile that is oxidized to produce oxidation products. It can be used in the manufacture of dyes and pharmaceuticals. The reaction mechanism for this compound starts with an electrophilic attack by one of the two carbonyl groups on a double bond in the propiophenone molecule. This produces an enol intermediate, which undergoes stepwise oxidation to form a carbonyl group, chloride ion, and acid catalyst. The acid catalyst can be recycled to reduce production costs. 3,4-Dimethoxypropiophenone also has stereoisomers that are chemically identical but have different three-dimensional shapes.</p>Formula:C11H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:194.23 g/mol3′,4′-Dimethoxypropiophenone
CAS:Formula:C11H14O3Purity:95%Color and Shape:Solid, Orange crystalline powderMolecular weight:194.23





