CAS 183506-66-3: APICIDIN
Description:Apicidin is a chemical compound known for its role as a histone deacetylase (HDAC) inhibitor, which is significant in the field of cancer research and epigenetics. It is derived from the natural product of the fungus *Fusarium* and has garnered attention for its potential therapeutic applications. Apicidin exhibits a unique structure that allows it to interact with the enzyme HDAC, leading to the modulation of gene expression. This modulation can result in the induction of cell cycle arrest and apoptosis in cancer cells, making it a candidate for anticancer drug development. Additionally, Apicidin has been studied for its effects on various cellular processes, including differentiation and proliferation. Its mechanism of action involves the alteration of acetylation status of histones, which can influence chromatin structure and gene accessibility. While promising, further research is necessary to fully understand its efficacy, safety, and potential side effects in clinical settings.
Formula:C34H49N5O6
InChI:InChI=1/C34H49N5O6/c1-5-22(3)30-34(44)38-19-13-12-18-29(38)33(43)35-26(16-9-7-8-14-24(40)6-2)31(41)36-27(32(42)37-30)20-23-21-39(45-4)28-17-11-10-15-25(23)28/h10-11,15,17,21-22,26-27,29-30H,5-9,12-14,16,18-20H2,1-4H3,(H,35,43)(H,36,41)(H,37,42)/t22-,26-,27-,29+,30-/m0/s1
- Synonyms:
- Cyclo-L-(2-Amino-8-Oxodeacanoyl)-L-(N-Methoxy-Tryptophan)-L-Isoleucyl-D-Pipecolinyl
- Cyclo-[L-(2-Amino-8-Oxodecanoyl)-L-(N-Methoxytryptophan)-L-Isoleucyl-D-Pipecolinyl
- Cyclo[(2S)-2-Amino-8-Oxodecanoyl-1-Methoxy-L-Tryptophyl-L-Isoleucyl-(2R)-2-Piperidinexcarbonyl]
- Apicidin, Fusarium Species
- (3S,6S,9S,15aR)-6-[(1-methoxy-1H-indol-3-yl)methyl]-9-[(1S)-1-methylpropyl]-3-(6-oxooctyl)octahydro-2H-pyrido[1,2-a][1,4,7,10]tetraazacyclododecine-1,4,7,10(3H,12H)-tetrone