CAS 1835705-53-7

1,1-Dimethylethyl 2-[2-[(6-chlorohexyl)oxy]ethoxy]acetate

Description:

1,1-Dimethylethyl 2-[2-[(6-chlorohexyl)oxy]ethoxy]acetate, identified by its CAS number 1835705-53-7, is an organic compound characterized by its complex structure, which includes an ester functional group. This compound features a tert-butyl group, which contributes to its steric bulk, and a chlorohexyl moiety that introduces chlorine into the molecular framework, potentially affecting its reactivity and solubility. The presence of ethoxy groups suggests that the compound may exhibit moderate polarity, influencing its interactions in various chemical environments. Additionally, the chloro substituent may impart unique biological or chemical properties, making it of interest in fields such as medicinal chemistry or materials science. The compound's synthesis and applications would likely be guided by its functional groups, which can participate in various chemical reactions, including nucleophilic substitutions or esterification processes. Overall, this compound's characteristics make it a subject of interest for further research and potential applications in diverse chemical contexts.

Formula: C₁₄H₂₇ClO₄

InChI: InChI=1S/C14H27ClO4/c1-14(2,3)19-13(16)12-18-11-10-17-9-7-5-4-6-8-15/h4-12H2,1-3H3

InChI key: InChIKey=GRFAVKLYDZBECC-UHFFFAOYSA-N

SMILES: C(COCCOCCCCCCCl)(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 2-[2-[(6-chlorohexyl)oxy]ethoxy]acetate
• Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]-, 1,1-dimethylethyl ester

PROTAC Linker 1

CAS: 1835705-53-7

Formula: C₁₄H₂₇ClO₄

Purity: 98%

Color and Shape: Liquid

Molecular weight: 294.8148

Ref: IN-DA01EO7T

Boc-C1-PEG2-C4-Cl

CAS: 1835705-53-7

Boc-C1-PEG2-C4-Cl

Purity: 98%

Molecular weight: 294.81g/mol

Ref: 54-OR1005060

Boc-C1-PEG2-C4-Cl

CAS: 1835705-53-7

Purity: 98%

Molecular weight: 294.16

Ref: 10-F554507

Boc-C1-PEG2-C4-Cl

CAS: 1835705-53-7

Boc-C1-PEG2-C4-Cl is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Boc-C1-PEG2-C4-Cl is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₄H₂₇ClO₄

Purity: Min. 95%

Molecular weight: 294.81 g/mol

Ref: 3D-KYC70553

Boc-C1-PEG2-C4-Cl

CAS: 1835705-53-7

Boc-C1-PEG2-C4-Cl (PROTAC Linker 1) is a PEG-based compound used as a linker in the synthesis and development of PROTACs[1].

Formula: C₁₄H₂₇ClO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.82

Ref: TM-T18637