CAS 1835759-80-2
:Methyl 3-(2-azidoethoxy)propanoate
Description:
Methyl 3-(2-azidoethoxy)propanoate is an organic compound characterized by its azido functional group, which imparts unique reactivity, particularly in click chemistry applications. This compound features an ester functional group, indicated by the presence of the methyl ester, which contributes to its solubility in organic solvents and its potential use in various synthetic pathways. The azido group is known for its ability to undergo nucleophilic substitution and cycloaddition reactions, making this compound valuable in the synthesis of more complex molecules. Additionally, the ethoxy group enhances the compound's stability and solubility. Methyl 3-(2-azidoethoxy)propanoate may be utilized in medicinal chemistry, materials science, and polymer chemistry due to its functional versatility. Safety considerations should be taken into account when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, this compound represents a useful building block in organic synthesis, particularly in the development of bioactive molecules and advanced materials.
Formula:C6H11N3O3
InChI:InChI=1S/C6H11N3O3/c1-11-6(10)2-4-12-5-3-8-9-7/h2-5H2,1H3
InChI key:InChIKey=LAQALTVGFQMCEV-UHFFFAOYSA-N
SMILES:O(CCC(OC)=O)CCN=[N+]=[N-]
Synonyms:- Methyl 3-(2-azidoethoxy)propanoate
- Propanoic acid, 3-(2-azidoethoxy)-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Azido-PEG1-methyl ester
CAS:Azido-PEG1-methyl ester is an alkyl/ether-based linker employed for the synthesis of PROTACs[1].Formula:C6H11N3O3Purity:98%Color and Shape:SolidMolecular weight:173.17Azido-PEG1-methyl ester
CAS:Azido-PEG1-methyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Azido-PEG1-methyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Formula:C6H11N3O3Purity:Min. 95%Molecular weight:173.17 g/mol

