CAS 1835759-82-4

3,6,9,12-Tetraoxa-2-azapentadecanedioic acid, 1-(1,1-dimethylethyl) ester

Description:

3,6,9,12-Tetraoxa-2-azapentadecanedioic acid, 1-(1,1-dimethylethyl) ester, is a chemical compound characterized by its complex structure, which includes multiple ether and amide functional groups. This compound features a long carbon chain, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the tetraoxa groups indicates that it has multiple oxygen atoms integrated into its structure, which can enhance solubility and reactivity. The azapentadecanedioic acid component suggests that it may exhibit properties typical of both amines and carboxylic acids, potentially allowing for diverse chemical reactivity. The tert-butyl ester group indicates that it may have increased stability and hydrophobic characteristics, making it suitable for specific applications where solubility in organic solvents is advantageous. Overall, this compound's unique structural features may lead to interesting biological or chemical properties, warranting further investigation for potential uses in various industrial and research applications.

Formula: C₁₄H₂₇NO₈

InChI: InChI=1S/C14H27NO8/c1-14(2,3)23-13(18)15-22-11-10-21-9-8-20-7-6-19-5-4-12(16)17/h4-11H2,1-3H3,(H,15,18)(H,16,17)

InChI key: InChIKey=FRMJMYYWQYLTQT-UHFFFAOYSA-N

SMILES: O(C(NOCCOCCOCCOCCC(O)=O)=O)C(C)(C)C

Synonyms:

• 3,6,9,12-Tetraoxa-2-azapentadecanedioic acid, 1-(1,1-dimethylethyl) ester

2,2-Dimethyl-4-oxo-3,6,9,12,15-pentaoxa-5-azaoctadecan-18-oic acid

CAS: 1835759-82-4

2,2-Dimethyl-4-oxo-3,6,9,12,15-pentaoxa-5-azaoctadecan-18-oic acid

Purity: 98%

Molecular weight: 337.37g/mol

Ref: 54-OR1067930

Boc-Aminooxy-PEG3-acid

CAS: 1835759-82-4

Boc-Aminooxy-PEG3-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₄H₂₇NO₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 337.37

Ref: TM-T14712

t-Boc-aminooxy-PEG3-acid

CAS: 1835759-82-4

t-Boc-aminooxy-PEG3-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. t-Boc-aminooxy-PEG3-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₄H₂₇NO₈

Purity: Min. 95%

Molecular weight: 337.37 g/mol

Ref: 3D-KYC75982