CAS 1835759-85-7

1-(1,1-Dimethylethyl) 4,7,10,13-tetraoxahexadecanedioate

Description:

1-(1,1-Dimethylethyl) 4,7,10,13-tetraoxahexadecanedioate, identified by its CAS number 1835759-85-7, is a chemical compound characterized by its unique structure that includes a long carbon chain with multiple ether linkages. This compound features a tert-butyl group (1,1-dimethylethyl) attached to a hexadecanedioate backbone, which consists of two carboxylate groups separated by a tetraether segment. The presence of ether linkages contributes to its potential solubility in various organic solvents and may influence its physical properties, such as melting and boiling points. Additionally, the compound's structure suggests it may exhibit interesting chemical reactivity and stability, making it suitable for applications in materials science, particularly in the development of polymers or surfactants. Its molecular design may also impart specific characteristics such as hydrophilicity or hydrophobicity, depending on the balance of functional groups present. Overall, this compound represents a class of polyfunctional molecules with potential utility in various chemical and industrial applications.

Formula: C₁₆H₃₀O₈

InChI: InChI=1S/C16H30O8/c1-16(2,3)24-15(19)5-7-21-9-11-23-13-12-22-10-8-20-6-4-14(17)18/h4-13H2,1-3H3,(H,17,18)

InChI key: InChIKey=LXMHKDZTUDTSCT-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCOCCOCCC(O)=O)=O)C(C)(C)C

Synonyms:

• 4,7,10,13-Tetraoxahexadecanedioic acid, 1-(1,1-dimethylethyl) ester
• 1-(1,1-Dimethylethyl) 4,7,10,13-tetraoxahexadecanedioate

Acid-PEG4-t-butyl ester

CAS: 1835759-85-7

Formula: C₁₆H₃₀O₈

Purity: 98%

Color and Shape: Liquid

Molecular weight: 350.4046

Ref: IN-DA019E37

Acid-PEG4-C2-BOC

CAS: 1835759-85-7

Acid-PEG4-C2-BOC

Purity: 98%

Molecular weight: 350.4g/mol

Ref: 54-OR1026354

Acid-PEG4-C2-Boc

CAS: 1835759-85-7

Acid-PEG4-C2-Boc, a PEG/alkyl-ether-based linker, is used in making PROTACs to inhibit mTOR.

Formula: C₁₆H₃₀O₈

Color and Shape: Solid

Molecular weight: 350.4

Ref: TM-T14105

2,2-Dimethyl-4-oxo-3,7,10,13,16-pentaoxanonadecan-19-oic acid

CAS: 1835759-85-7

Purity: 98%

Color and Shape: Liquid

Molecular weight: 350.4079895

Ref: 10-F867599

Acid-PEG4-t-butyl ester

CAS: 1835759-85-7

Acid-PEG4-t-butyl ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Acid-PEG4-t-butyl ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₆H₃₀O₈

Purity: Min. 95%

Molecular weight: 350.41 g/mol

Ref: 3D-KYC75985