CAS 183582-92-5: 1,3,5-CYCLOHEXANETRICARBONITRILE

Description:1,3,5-Cyclohexanetricarbonitrile, with the CAS number 183582-92-5, is a chemical compound characterized by its cyclic structure and the presence of three cyano (–C≡N) groups attached to a cyclohexane ring. This compound is typically a solid at room temperature and exhibits a crystalline appearance. The presence of multiple cyano groups contributes to its potential reactivity, making it a subject of interest in various chemical applications, including organic synthesis and materials science. The cyano groups can participate in nucleophilic reactions and can also influence the compound's solubility and polarity. Additionally, 1,3,5-cyclohexanetricarbonitrile may exhibit interesting thermal and chemical stability, which can be advantageous in specific industrial processes. Its unique structure and functional groups may also allow for the formation of polymers or coordination complexes, expanding its utility in advanced materials and chemical research. As with many nitriles, safety precautions should be taken when handling this compound due to potential toxicity and environmental concerns.

Formula:C₉H₉N₃

InChI:InChI=1/C9H9N3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h7-9H,1-3H2

Synonyms:
1,3,5-Tricyanocyclohexane
(1alpha,3alpha,5alpha)-1,3,5-Cyclohexanetricarbonitrile
(1alpha,3alpha,5alpha)-1,3,5-Tricyanocyclohexane
Cyclohexane-1,3,5-Tricarbonitrile
1,3,5-Cyclohexanetricarbonitrile

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1,3,5-Cyclohexanetricarbonitrile (cis- and trans- mixture) REF: 3B-C2327CAS: 183582-92-5	>98.0%(GC)	130.00 €	Tue 29 Apr 25
1,3,5-Cyclohexanetricarbonitrile REF: IN-DA0027PUCAS: 183582-92-5	98.0%	93.00 €~153.00 €	Tue 06 May 25
1,3,5-Cyclohexanetricarbonitrile (cis- and trans- mixture) REF: 3D-IHA58292CAS: 183582-92-5	Min. 95%	- - -	Discontinued product