CymitQuimica logo

CAS 1836-87-9

:

9-Benzylidene fluorene

Description:
9-Benzylidene fluorene is an organic compound characterized by its structure, which features a fluorene core with a benzylidene group attached at the 9-position. This compound typically appears as a yellow to orange solid and is known for its stability and relatively low solubility in water, making it more soluble in organic solvents. It exhibits interesting photophysical properties, including fluorescence, which makes it of interest in various applications such as organic light-emitting diodes (OLEDs) and as a potential material in organic photovoltaics. The compound's molecular structure contributes to its electronic properties, allowing it to participate in various chemical reactions, including electrophilic substitutions. Additionally, 9-benzylidene fluorene can serve as a precursor for synthesizing other complex organic molecules. Its reactivity and stability under different conditions make it a valuable compound in organic synthesis and materials science. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to potential health hazards associated with exposure.
Formula:C22H16
InChI:InChI=1/C22H16/c1-2-9-17(10-3-1)11-8-16-22-20-14-6-4-12-18(20)19-13-5-7-15-21(19)22/h1-16H/b11-8+
InChI key:RMQMLYMBZGDKBY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C=C2C3=CC=CC=C3C4=CC=CC=C42
Synonyms:
  • 9-Benzylidenefluorene
  • 9-benzylidene-9H-fluorene
  • 9-[(2E)-3-phenylprop-2-en-1-ylidene]-9H-fluorene
Found 4 products.