CAS 183610-70-0
:2-Amino-3-(trifluoromethyl)pyridine
Description:
2-Amino-3-(trifluoromethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 2-position and a trifluoromethyl group (-CF3) at the 3-position significantly influences its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits basic properties due to the amino group, making it a potential nucleophile in various chemical reactions. The trifluoromethyl group enhances the compound's lipophilicity and can affect its reactivity and stability, often making it a valuable building block in medicinal chemistry and agrochemicals. Additionally, the presence of fluorine atoms can impart unique electronic properties, influencing the compound's interaction with biological targets. Overall, 2-Amino-3-(trifluoromethyl)pyridine is of interest in research and development due to its potential applications in pharmaceuticals and materials science.
Formula:C6H5F3N2
InChI:InChI=1/C6H5F3N2/c7-6(8,9)4-2-1-3-11-5(4)10/h1-3H,(H2,10,11)
SMILES:c1cc(c(N)nc1)C(F)(F)F
Synonyms:- 3-(Trifluoromethyl)-2-Pyridinamine
- 3-Trifluoromethyl-Pyridin-2-Ylamine
- Ethyl 5-Chloro-2,2,3,3,4,4-Hexafluoro-5-Oxopentanoate
- 3-(Trifluoromethyl)Pyridin-2-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-3-(trifluoromethyl)pyridine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5F3N2Purity:97%Color and Shape:White to yellow or cream, Powder or crystalline powder or solidMolecular weight:162.122-Pyridinamine, 3-(trifluoromethyl)-
CAS:Formula:C6H5F3N2Purity:98%Color and Shape:SolidMolecular weight:162.11252-Amino-3-(trifluoromethyl)pyridine
CAS:2-Amino-3-(trifluoromethyl)pyridineFormula:C6H5F3N2Purity:98%Color and Shape: off-white solidMolecular weight:162.11g/mol2-Amino-3-trifluoromethylpyridine
CAS:Formula:C6H5F3N2Purity:97%Color and Shape:SolidMolecular weight:162.115



