CAS 183616-18-4

3-(Hydroxymethyl)cyclobutanone

Description:

3-(Hydroxymethyl)cyclobutanone is a cyclic ketone characterized by a four-membered cyclobutane ring with a hydroxymethyl group (-CH2OH) attached to the third carbon. This compound features a carbonyl group (C=O) typical of ketones, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group enhances its polarity and solubility in polar solvents, making it a versatile intermediate in various chemical reactions. Its structure allows for unique stereochemical properties, which can influence its behavior in biological systems and chemical processes. Additionally, 3-(Hydroxymethyl)cyclobutanone may exhibit interesting reactivity patterns, such as participating in nucleophilic addition reactions due to the electrophilic nature of the carbonyl carbon. This compound is of interest in the fields of medicinal chemistry and materials science, where it may serve as a building block for more complex molecules. As with many organic compounds, proper handling and safety precautions should be observed due to potential hazards associated with its chemical properties.

Formula: C₅H₈O₂

InChI: InChI=1/C5H8O2/c6-3-4-1-5(7)2-4/h4,6H,1-3H2

SMILES: C1C(CC1=O)CO

Synonyms:

• Cyclobutanone, 3-(Hydroxymethyl)-
• 3-(Hydroxymethyl)Cyclobutan-1-One

Cyclobutanone, 3-(hydroxymethyl)-

CAS: 183616-18-4

Formula: C₅H₈O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 100.1158

Ref: IN-DA0027RP

3-(Hydroxymethyl)cyclobutan-1-one

CAS: 183616-18-4

3-(Hydroxymethyl)cyclobutan-1-one

Formula: C₅H₈O₂

Purity: 90%

Color and Shape: clear colourless to pale yellow liquid

Molecular weight: 100.12g/mol

Ref: 54-OR308103

3-(Hydroxymethyl)cyclobutanone

CAS: 183616-18-4

Formula: C₅H₈O₂

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 100.117

Ref: 10-F067777

3-(Hydroxymethyl)cyclobutan-1-one

CAS: 183616-18-4

3-(Hydroxymethyl)cyclobutan-1-one is a synthetic piperazine derivative that has been shown to have antitumor and antimycobacterial activities. It is a selective inhibitor of the enzyme purine nucleoside phosphorylase (PNP), which catalyzes the conversion of inosine monophosphate (IMP) to xanthosine monophosphate (XMP). This inhibition results in an accumulation of IMP and deoxyinosine monophosphate (dIMP) in tumor cells. 3-(Hydroxymethyl)cyclobutan-1-one also inhibits Mycobacterium tuberculosis, but not other bacteria such as Escherichia coli or Staphylococcus aureus. The product is synthetically produced by reacting cyclobutanone with hydroxylamine.

Formula: C₅H₈O₂

Purity: Min. 95%

Molecular weight: 100.12 g/mol

Ref: 3D-IHA61618