CAS 183616-18-4
:3-(Hydroxymethyl)cyclobutanone
Description:
3-(Hydroxymethyl)cyclobutanone is a cyclic ketone characterized by a four-membered cyclobutane ring with a hydroxymethyl group (-CH2OH) attached to the third carbon. This compound features a carbonyl group (C=O) typical of ketones, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group enhances its polarity and solubility in polar solvents, making it a versatile intermediate in various chemical reactions. Its structure allows for unique stereochemical properties, which can influence its behavior in biological systems and chemical processes. Additionally, 3-(Hydroxymethyl)cyclobutanone may exhibit interesting reactivity patterns, such as participating in nucleophilic addition reactions due to the electrophilic nature of the carbonyl carbon. This compound is of interest in the fields of medicinal chemistry and materials science, where it may serve as a building block for more complex molecules. As with many organic compounds, proper handling and safety precautions should be observed due to potential hazards associated with its chemical properties.
Formula:C5H8O2
InChI:InChI=1/C5H8O2/c6-3-4-1-5(7)2-4/h4,6H,1-3H2
SMILES:C1C(CC1=O)CO
Synonyms:- Cyclobutanone, 3-(Hydroxymethyl)-
- 3-(Hydroxymethyl)Cyclobutan-1-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclobutanone, 3-(hydroxymethyl)-
CAS:Formula:C5H8O2Purity:97%Color and Shape:LiquidMolecular weight:100.1158Ref: IN-DA0027RP
25gTo inquire50gTo inquire100mg39.00€250mg56.00€500mg63.00€1g84.00€5g186.00€10g316.00€3-(Hydroxymethyl)cyclobutan-1-one
CAS:3-(Hydroxymethyl)cyclobutan-1-oneFormula:C5H8O2Purity:90%Color and Shape: clear colourless to pale yellow liquidMolecular weight:100.12g/mol3-(Hydroxymethyl)cyclobutanone
CAS:Formula:C5H8O2Purity:97%Color and Shape:Liquid, ClearMolecular weight:100.1173-(Hydroxymethyl)cyclobutan-1-one
CAS:3-(Hydroxymethyl)cyclobutan-1-one is a synthetic piperazine derivative that has been shown to have antitumor and antimycobacterial activities. It is a selective inhibitor of the enzyme purine nucleoside phosphorylase (PNP), which catalyzes the conversion of inosine monophosphate (IMP) to xanthosine monophosphate (XMP). This inhibition results in an accumulation of IMP and deoxyinosine monophosphate (dIMP) in tumor cells. 3-(Hydroxymethyl)cyclobutan-1-one also inhibits Mycobacterium tuberculosis, but not other bacteria such as Escherichia coli or Staphylococcus aureus. The product is synthetically produced by reacting cyclobutanone with hydroxylamine.Formula:C5H8O2Purity:Min. 95%Molecular weight:100.12 g/mol



