CAS 183619-38-7

4-Acetamido-N-(tert-butyl)benzamide

Description:

4-Acetamido-N-(tert-butyl)benzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. This compound features a benzene ring substituted with an acetamido group and a tert-butyl group, contributing to its unique properties. The presence of the acetamido group enhances its solubility in polar solvents, while the bulky tert-butyl group can influence its steric hindrance and overall molecular conformation. This compound is typically a white to off-white solid and is used in various chemical applications, including pharmaceuticals and organic synthesis. Its molecular structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the benzene ring. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1/C13H18N2O2/c1-9(16)14-11-7-5-10(6-8-11)12(17)15-13(2,3)4/h5-8H,1-4H3,(H,14,16)(H,15,17)

SMILES: CC(=Nc1ccc(cc1)C(=O)NC(C)(C)C)O

Synonyms:

• Ren-1189
• Cpi-1189
• 4-(acetylamino)-N-tert-butylbenzamide

CPI-1189

CAS: 183619-38-7

Formula: C₁₃H₁₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.2942

Ref: IN-DA00AS51

CPI1189

CAS: 183619-38-7

CPI1189

Purity: ≥98%

Molecular weight: 234.29g/mol

Ref: 54-BUP15653

CPI1189

CAS: 183619-38-7

CPI1189 (REN-1189) is a TNF-a release inhibitor potentially for the treatment of sciatica and postherpetic neuralgia.

Formula: C₁₃H₁₈N₂O₂

Purity: 98.34% - 99.51%

Color and Shape: Solid

Molecular weight: 234.29

Ref: TM-T3561

4-Acetamido-N-(tert-butyl)benzamide

CAS: 183619-38-7

Purity: ≥98%

Molecular weight: 234.299

Ref: 10-F981175