CAS 18365-82-7
:2-phospholactic acid
Description:
2-Phospholactic acid, with the CAS number 18365-82-7, is an organic compound that features both a carboxylic acid and a phosphate group, making it a phosphonic acid derivative. It is characterized by its molecular structure, which includes a chiral center, resulting in potential stereoisomerism. This compound is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. 2-Phospholactic acid is known for its role in biochemical processes, particularly in the metabolism of phospholipids and as a potential intermediate in various synthetic pathways. Its properties include being hygroscopic and having a relatively low melting point. The compound is of interest in research related to biochemistry and pharmaceuticals, particularly for its potential applications in drug development and as a biochemical marker. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse reactions.
Formula:C3H7O6P
InChI:InChI=1/C3H7O6P/c1-3(6,2(4)5)10(7,8)9/h6H,1H3,(H,4,5)(H2,7,8,9)
SMILES:CC(C(=O)O)(O)P(=O)(O)O
Synonyms:- Calcium lactophosphoric acid
- Propanoic acid, 2-(phosphonooxy)-
- 2-(Phosphonooxy)Propanoic Acid
- 2-Hydroxy-2-Phosphonopropanoic Acid
- 2-Phospholactic acid
- DL-2-Phospholactic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
