CAS 183673-71-4
:4-N-BOC-1,1-Amino-piperidinyl carboxylic acid
Description:
4-N-BOC-1,1-Amino-piperidinyl carboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The "N-BOC" (tert-butoxycarbonyl) group serves as a protective group for the amino functionality, enhancing the compound's stability and solubility in various solvents. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar organic solvents. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules, due to its ability to participate in various chemical reactions, including amide bond formation. The carboxylic acid functional group contributes to its acidity and reactivity, making it a versatile intermediate in synthetic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C11H20N2O4
InChI:InChI=1/C11H20N2O4/c1-10(2,3)17-9(16)13-6-4-11(12,5-7-13)8(14)15/h4-7,12H2,1-3H3,(H,14,15)
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)N
Synonyms:- 4-Amino-1-Boc-piperidine-4-carboxylic acid
- 4-N-BOC-1,1-Amino-piperidinyl carboxylic acid hydrate
- 4-Amino-1-(Boc-amino)piperidine-4-carboxylic acid
- 4-N-(tert-Butoxycarbonyl)-1,1-amino-piperidinyl carboxylic acid hemihydrate
- 4-Amino-1-(tert-butoxycarbonyl)piperidine-4-carboxylic acid
- 1-Boc-4-aminopiperidine-4-carboxylic acid
- 4-Amino-1-Boc-4-piperidinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-1-Boc-piperidine-4-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H20N2O4Purity:98%Color and Shape:White, PowderMolecular weight:244.291-Boc-4-aminopiperidine-4-carboxylic acid
CAS:Formula:C11H20N2O4Purity:97%Color and Shape:SolidMolecular weight:244.28754-Amino-1-Boc-piperidine-4-carboxylic acid
CAS:4-Amino-1-Boc-piperidine-4-carboxylic acidPurity:97%Molecular weight:244.29g/mol4-Amino-1-Boc-piperidine-4-carboxylic acid
CAS:Formula:C11H20N2O4Purity:97%Color and Shape:SolidMolecular weight:244.2911-Boc-4-aminopiperidine-4-carboxylic acid
CAS:Please enquire for more information about 1-Boc-4-aminopiperidine-4-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H20N2O4Purity:Min. 95%Color and Shape:White To Beige SolidMolecular weight:244.29 g/mol





