CAS 18372-11-7
:3,8,12,17-tetramethyl-21H,23H-Porphine-2,7,13,18-tetrapropanoic acid
Description:
3,8,12,17-tetramethyl-21H,23H-Porphine-2,7,13,18-tetrapropanoic acid, with CAS number 18372-11-7, is a synthetic porphyrin derivative characterized by its complex cyclic structure, which includes four pyrrole rings interconnected by methine bridges. This compound features four methyl groups and four propanoic acid side chains, contributing to its solubility and reactivity. The presence of the propanoic acid groups enhances its hydrophilicity, making it more soluble in polar solvents compared to other porphyrins. This porphyrin is notable for its potential applications in photodynamic therapy, as it can absorb light and produce reactive oxygen species, which can be utilized in cancer treatment. Additionally, its unique structure allows for various modifications, making it a versatile compound in biochemical research and materials science. The compound's stability, light-absorbing properties, and ability to form complexes with metal ions further enhance its utility in various chemical and biological applications.
Formula:C36H38N4O8
InChI:InChI=1/C36H38N4O8/c1-17-21(5-9-33(41)42)29-14-27-19(3)23(7-11-35(45)46)31(39-27)16-32-24(8-12-36(47)48)20(4)28(40-32)15-30-22(6-10-34(43)44)18(2)26(38-30)13-25(17)37-29/h13-16,39-40H,5-12H2,1-4H3,(H,41,42)(H,43,44)(H,45,46)(H,47,48)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-
InChI key:InChIKey=WEUFSMQSXVJGBC-VJCKZMALSA-N
SMILES:C(CC(O)=O)C1=C2C=C3C(CCC(O)=O)=C(C)C(=N3)C=C4C(CCC(O)=O)=C(C)C(N4)=CC5=NC(=CC(N2)=C1C)C(CCC(O)=O)=C5C
Synonyms:- 2,7,13,18-Porphinetetrapropionic acid, 3,8,12,17-tetramethyl-
- 21H,23H-Porphine-2,7,13,18-tetrapropanoic acid, 3,8,12,17-tetramethyl-
- 3,3',3'',3'''-(3,8,12,17-Tetramethylporphyrin-2,7,13,18-Tetrayl)Tetrapropanoic Acid
- Coproporphyrin IV
- 3,8,12,17-Tetramethyl-21H,23H-porphine-2,7,13,18-tetrapropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-H-042011
Discontinued product
