CAS 18374-36-2

phenyl N,N-bis(2-chloroethyl)phosphorodiamidate

Description:

Phenyl N,N-bis(2-chloroethyl)phosphorodiamidate, with the CAS number 18374-36-2, is an organophosphorus compound characterized by its phosphorodiamidate structure. This substance features a phenyl group attached to a phosphorus atom, which is further bonded to two 2-chloroethyl groups and two amine functionalities. The presence of the chloroethyl groups suggests potential reactivity, particularly in nucleophilic substitution reactions, making it of interest in various chemical applications, including as a potential pesticide or herbicide. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is important to handle this substance with care due to its potential toxicity and environmental impact, as many organophosphorus compounds can inhibit acetylcholinesterase, leading to neurotoxic effects. Proper safety measures, including the use of personal protective equipment and adherence to regulatory guidelines, are essential when working with this chemical.

Formula: C₁₀H₁₅Cl₂N₂O₂P

InChI: InChI=1/C10H15Cl2N2O2P/c11-6-8-14(9-7-12)17(13,15)16-10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,13,15)

SMILES: c1ccc(cc1)OP(=O)(N)N(CCCl)CCCl