CAS 183741-91-5: 5-Amino-2-methoxy-4-pyridinecarboxylic acid

Description:5-Amino-2-methoxy-4-pyridinecarboxylic acid, with the CAS number 183741-91-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, as well as a carboxylic acid group (-COOH) that contributes to its acidic properties. The presence of these functional groups suggests that it may exhibit both basic and acidic behavior, making it a potential candidate for various chemical reactions and applications in pharmaceuticals or agrochemicals. The methoxy group can influence the compound's solubility and reactivity, while the amino group may participate in hydrogen bonding. Additionally, the compound's structure allows for potential interactions with biological systems, which could be explored for medicinal chemistry purposes. Overall, 5-Amino-2-methoxy-4-pyridinecarboxylic acid is a versatile compound with interesting chemical properties that warrant further investigation.

Formula:C₇H₈N₂O₃

InChI:InChI=1S/C7H8N2O3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3H,8H2,1H3,(H,10,11)

InChI key:InChIKey=BFYPMZJYCXUXFW-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(=NC=C1N)OC

Synonyms:
4-Pyridinecarboxylic acid, 5-amino-2-methoxy-
5-Amino-2-Methoxy-Isonicotinic Acid
5-Amino-2-methoxyisonicotinic acid
5-Amino-2-methoxypyridine-4-carboxylic acid
5-Amino-2-methoxy-4-pyridinecarboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-Amino-2-methoxyisonicotinic acid REF: IN-DA003MDDCAS: 183741-91-5	97%	27.00 €~561.00 €	Fri 14 Mar 25
5-Amino-2-methoxypyridine-4-carboxylic acid REF: 54-OR76039CAS: 183741-91-5	95%	148.00 €~5,352.00 €	Mon 17 Mar 25
5-Amino-2-methoxyisonicotinic acid REF: 10-F225090CAS: 183741-91-5	95.0%	To inquire	Mon 24 Mar 25
5-Amino-2-methoxyisonicotinic acid REF: 3D-FA51593CAS: 183741-91-5	Min. 95%	To inquire	Fri 09 May 25