CAS 1838-56-8
:N-(3-Hydroxy-9H-fluoren-2-yl)acetamide
Description:
N-(3-Hydroxy-9H-fluoren-2-yl)acetamide, with the CAS number 1838-56-8, is an organic compound characterized by its structure, which includes a fluorenyl moiety substituted with a hydroxyl group and an acetamide functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic fluorenyl core. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, which can influence its solubility and reactivity. N-(3-Hydroxy-9H-fluoren-2-yl)acetamide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various applications, including use as a building block in organic synthesis or as a potential ligand in coordination chemistry. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in experimental settings. Overall, this compound represents a versatile structure with potential implications in various fields of chemistry and biochemistry.
Formula:C15H13NO2
InChI:InChI=1/C15H13NO2/c1-9(17)16-14-7-11-6-10-4-2-3-5-12(10)13(11)8-15(14)18/h2-5,7-8,18H,6H2,1H3,(H,16,17)
InChI key:InChIKey=MNPABTKJCQDDNY-UHFFFAOYSA-N
SMILES:OC=1C=C2C=3C(CC2=CC1NC(C)=O)=CC=CC3
Synonyms:- 2-Acetylamino-3-hydroxyfluorene
- 3-Ho-Aaf
- 3-Hydroxy-2-acetamidofluorene
- 3-Hydroxy-N-acetyl-2-aminofluorene
- 3-Hydroxyacetylaminofluorene
- Acetamide, N-(3-hydroxy-9H-fluoren-2-yl)-
- Acetamide, N-(3-hydroxy-9H-fluoren-2-yl)- (9CI)
- Acetamide, N-(3-hydroxyfluoren-2-yl)-
- Brn 2811033
- Ccris 2767
- N-(3-Hydroxy-2-fluorenyl)acetamide
- N-(3-hydroxy-9H-fluoren-2-yl)acetamide
- Nsc 40564
- Nsc 46731
- 3-Hydroxy-2-acetylaminofluorene
- Inchi=1/C15H13no2/C1-9(17)16-14-7-11-6-10-4-2-3-5-12(10)13(11)8-15(14)18/H2-5,7-8,18H,6H2,1H3,(H,16,17
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Hydroxy-N-acetyl-2-aminofluorene
CAS:Controlled ProductFormula:C15H13NO2Color and Shape:NeatMolecular weight:239.2693-Hydroxy-N-acetyl-2-aminofluorene
CAS:3-Hydroxy-N-acetyl-2-aminofluorene is a potent inhibitor of protein kinases, which play a crucial role in the regulation of cellular processes such as proliferation, differentiation, and apoptosis. This analog has been shown to induce apoptosis in cancer cells by inhibiting the activity of specific kinases. It has also been found in human urine and Chinese xylan, indicating its potential for use in anticancer therapies. 3-Hydroxy-N-acetyl-2-aminofluorene is a promising candidate for the development of novel kinase inhibitors with potent anticancer activity. Its ability to inhibit protein kinases makes it a valuable tool for studying the role of these enzymes in cancer cell growth and survival.Formula:C15H13NO2Purity:Min. 95%Molecular weight:239.27 g/mol

