CymitQuimica logo

CAS 183803-06-7

:

Phenol, 5-iodo-2-methyl-

Description:
Phenol, 5-iodo-2-methyl- is an organic compound characterized by the presence of a hydroxyl group (-OH) attached to a benzene ring, which is further substituted with an iodine atom at the 5-position and a methyl group at the 2-position. This compound belongs to the class of halogenated phenols, which are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the iodine atom enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Phenol derivatives, including this compound, often exhibit antimicrobial properties and can be involved in the synthesis of more complex organic molecules. Safety considerations are important when handling this compound, as phenolic compounds can be toxic and irritant to skin and mucous membranes. Proper safety protocols should be followed in laboratory settings.
Formula:C7H7IO
InChI:InChI=1S/C7H7IO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3
InChI key:VVVBRLLERZUWBH-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)I)O
Found 5 products.